C23H34O2Si — CID 11474187
(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol (PubChem CID 11474187) has the molecular formula C23H34O2Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol.
| Compound Name | (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 11474187 |
| Molecular Formula | C23H34O2Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentan-1-ol |
| SMILES | C[C@H](CO)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H34O2Si/c1-19(17-24)16-20(2)18-25-26(23(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,19-20,24H,16-18H2,1-5H3/t19-,20+/m0/s1 |
| InChIKey | NBIHJOZBHSUWNL-VQTJNVASSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|