C13H21N3 — CID 114742569
2,4-dipropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (PubChem CID 114742569) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2,4-dipropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine.
| Compound Name | 2,4-dipropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 114742569 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2,4-dipropyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| SMILES | CCCc1nc(CCC)c2c(n1)CNCC2 |
| InChI | InChI=1S/C13H21N3/c1-3-5-11-10-7-8-14-9-12(10)16-13(15-11)6-4-2/h14H,3-9H2,1-2H3 |
| InChIKey | LCNQAKAHLZRLPF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |