C23H25NO2S — CID 11474450
(3-ethyl-2-thiophen-3-ylquinolin-6-yl)-(4-methoxycyclohexyl)methanone (PubChem CID 11474450) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is (3-ethyl-2-thiophen-3-ylquinolin-6-yl)-(4-methoxycyclohexyl)methanone.
| Compound Name | (3-ethyl-2-thiophen-3-ylquinolin-6-yl)-(4-methoxycyclohexyl)methanone |
|---|---|
| PubChem CID | 11474450 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (3-ethyl-2-thiophen-3-ylquinolin-6-yl)-(4-methoxycyclohexyl)methanone |
| SMILES | CCc1cc2cc(C(=O)C3CCC(OC)CC3)ccc2nc1-c1ccsc1 |
| InChI | InChI=1S/C23H25NO2S/c1-3-15-12-19-13-17(23(25)16-4-7-20(26-2)8-5-16)6-9-21(19)24-22(15)18-10-11-27-14-18/h6,9-14,16,20H,3-5,7-8H2,1-2H3 |
| InChIKey | KPQFFGITPXRODU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |