C16H19NOS — CID 114744967
N-[3,4-dihydro-2H-chromen-8-yl(thiophen-3-yl)methyl]ethanamine (PubChem CID 114744967) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is N-[3,4-dihydro-2H-chromen-8-yl(thiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[3,4-dihydro-2H-chromen-8-yl(thiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114744967 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[3,4-dihydro-2H-chromen-8-yl(thiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccsc1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H19NOS/c1-2-17-15(13-8-10-19-11-13)14-7-3-5-12-6-4-9-18-16(12)14/h3,5,7-8,10-11,15,17H,2,4,6,9H2,1H3 |
| InChIKey | ZRJSYANXTZQEJZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |