C16H17N9OS — CID 11474549
2-(furan-2-yl)-5-[4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11474549) has the molecular formula C16H17N9OS and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11474549 |
| Molecular Formula | C16H17N9OS |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCN(Cc3cscn3)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C16H17N9OS/c17-14-20-15(21-16-19-13(22-25(14)16)12-2-1-7-26-12)24-5-3-23(4-6-24)8-11-9-27-10-18-11/h1-2,7,9-10H,3-6,8H2,(H2,17,19,20,21,22) |
| InChIKey | MZZGPNSBRUSHBV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |