C15H17N3O — CID 114747256
6-(2,3-dihydro-1-benzofuran-7-yl)-N-propylpyrazin-2-amine (PubChem CID 114747256) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 6-(2,3-dihydro-1-benzofuran-7-yl)-N-propylpyrazin-2-amine.
| Compound Name | 6-(2,3-dihydro-1-benzofuran-7-yl)-N-propylpyrazin-2-amine |
|---|---|
| PubChem CID | 114747256 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 6-(2,3-dihydro-1-benzofuran-7-yl)-N-propylpyrazin-2-amine |
| SMILES | CCCNc1cncc(-c2cccc3c2OCC3)n1 |
| InChI | InChI=1S/C15H17N3O/c1-2-7-17-14-10-16-9-13(18-14)12-5-3-4-11-6-8-19-15(11)12/h3-5,9-10H,2,6-8H2,1H3,(H,17,18) |
| InChIKey | FHZNDWHVKSMWRI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |