C13H14N4O2 — CID 114747408
4-(3,4-dihydro-2H-chromen-8-yl)-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 114747408) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-8-yl)-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,4-dihydro-2H-chromen-8-yl)-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114747408 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-8-yl)-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(-c2cccc3c2OCCC3)n1 |
| InChI | InChI=1S/C13H14N4O2/c1-18-13-16-11(15-12(14)17-13)9-6-2-4-8-5-3-7-19-10(8)9/h2,4,6H,3,5,7H2,1H3,(H2,14,15,16,17) |
| InChIKey | SVXOZWFWULFIMB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |