C18H25F7O — CID 11474766
1-[1,6-difluoro-4-methyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]nonan-1-one (PubChem CID 11474766) has the molecular formula C18H25F7O and a molecular weight of 390.38 g/mol. Its IUPAC name is 1-[1,6-difluoro-4-methyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]nonan-1-one.
| Compound Name | 1-[1,6-difluoro-4-methyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 11474766 |
| Molecular Formula | C18H25F7O |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[1,6-difluoro-4-methyl-6-(1,1,2,2,2-pentafluoroethyl)cyclohex-3-en-1-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)C1(F)CC=C(C)CC1(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H25F7O/c1-3-4-5-6-7-8-9-14(26)15(19)11-10-13(2)12-16(15,20)17(21,22)18(23,24)25/h10H,3-9,11-12H2,1-2H3 |
| InChIKey | QVNVFHCUMUTIQG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|