About 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one
5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 11474909) has the molecular formula C22H16Cl2N2O
and a molecular weight of 395.29 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 11474909 |
| Molecular Formula | C22H16Cl2N2O |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)CN=C(c2cc(Cl)cc(Cl)c2)c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C22H16Cl2N2O/c1-26-20-8-7-15(14-5-3-2-4-6-14)11-19(20)22(25-13-21(26)27)16-9-17(23)12-18(24)10-16/h2-12H,13H2,1H3 |
| InChIKey | UFESVDPGJHMMFB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one (CID 11474909) is 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one is CN1C(=O)CN=C(c2cc(Cl)cc(Cl)c2)c2cc(-c3ccccc3)ccc21.
What is the InChIKey of 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is UFESVDPGJHMMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2N2O/c1-26-20-8-7-15(14-5-3-2-4-6-14)11-19(20)22(25-13-21(26)27)16-9-17(23)12-18(24)10-16/h2-12H,13H2,1H3.
What are the key properties of 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one?
5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 395.29 g/mol, XLogP of 5.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-1-methyl-7-phenyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 11474909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).