About N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine
N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 114749206) has the molecular formula C11H16F3NS
and a molecular weight of 251.32 g/mol. Its IUPAC name is N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine |
| PubChem CID | 114749206 |
| Molecular Formula | C11H16F3NS |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | CCCCc1cc(CNCC(F)(F)F)cs1 |
| InChI | InChI=1S/C11H16F3NS/c1-2-3-4-10-5-9(7-16-10)6-15-8-11(12,13)14/h5,7,15H,2-4,6,8H2,1H3 |
| InChIKey | CTKSESLATQTSIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine?
The IUPAC name of N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine (CID 114749206) is N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine.
What is the SMILES notation for N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine?
The canonical SMILES for N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine is CCCCc1cc(CNCC(F)(F)F)cs1.
What is the InChIKey of N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine?
The InChIKey is CTKSESLATQTSIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3NS/c1-2-3-4-10-5-9(7-16-10)6-15-8-11(12,13)14/h5,7,15H,2-4,6,8H2,1H3.
What are the key properties of N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine?
N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine has a molecular weight of 251.32 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-butylthiophen-3-yl)methyl]-2,2,2-trifluoroethanamine is sourced from PubChem (CID 114749206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).