C14H15NS — CID 114749286
6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-3-amine (PubChem CID 114749286) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-3-amine.
| Compound Name | 6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 114749286 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-3-amine |
| SMILES | Nc1csc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C14H15NS/c15-13-9-16-14-8-11(6-7-12(13)14)10-4-2-1-3-5-10/h1-5,9,11H,6-8,15H2 |
| InChIKey | GZRYQXHUHHHGRM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |