C14H18N2O5 — CID 114749614
methyl 3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]-4-nitrobenzoate (PubChem CID 114749614) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]-4-nitrobenzoate.
| Compound Name | methyl 3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]-4-nitrobenzoate |
|---|---|
| PubChem CID | 114749614 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | methyl 3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(NCC2(CCO)CC2)c1 |
| InChI | InChI=1S/C14H18N2O5/c1-21-13(18)10-2-3-12(16(19)20)11(8-10)15-9-14(4-5-14)6-7-17/h2-3,8,15,17H,4-7,9H2,1H3 |
| InChIKey | KMLNKVKAZFDUEJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|