About N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine
N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine (PubChem CID 11474974) has the molecular formula C19H13ClN4S2
and a molecular weight of 396.93 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine |
| PubChem CID | 11474974 |
| Molecular Formula | C19H13ClN4S2 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine |
| SMILES | CC1Sc2ccc(Cl)cc2-c2nc(Nc3nc4ccccc4s3)ncc21 |
| InChI | InChI=1S/C19H13ClN4S2/c1-10-13-9-21-18(24-19-22-14-4-2-3-5-16(14)26-19)23-17(13)12-8-11(20)6-7-15(12)25-10/h2-10H,1H3,(H,21,22,23,24) |
| InChIKey | TVDWKGACCOCOEA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
The IUPAC name of N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine (CID 11474974) is N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine.
What is the SMILES notation for N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
The canonical SMILES for N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine is CC1Sc2ccc(Cl)cc2-c2nc(Nc3nc4ccccc4s3)ncc21.
What is the InChIKey of N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
The InChIKey is TVDWKGACCOCOEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClN4S2/c1-10-13-9-21-18(24-19-22-14-4-2-3-5-16(14)26-19)23-17(13)12-8-11(20)6-7-15(12)25-10/h2-10H,1H3,(H,21,22,23,24).
What are the key properties of N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine?
N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine has a molecular weight of 396.93 g/mol, XLogP of 6.32, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-yl)-9-chloro-5-methyl-5H-thiochromeno[4,3-d]pyrimidin-2-amine is sourced from PubChem (CID 11474974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).