C24H34O3Si — CID 11475029
(17S)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,11,13,15-tetraynoic acid (PubChem CID 11475029) has the molecular formula C24H34O3Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (17S)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,11,13,15-tetraynoic acid.
| Compound Name | (17S)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,11,13,15-tetraynoic acid |
|---|---|
| PubChem CID | 11475029 |
| Molecular Formula | C24H34O3Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (17S)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,11,13,15-tetraynoic acid |
| SMILES | C[C@@H](C#CC#CC#CC#CCCCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H34O3Si/c1-22(27-28(5,6)24(2,3)4)20-18-16-14-12-10-8-7-9-11-13-15-17-19-21-23(25)26/h22H,9,11,13,15,17,19,21H2,1-6H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | VSJQHLZVNKRKGT-QFIPXVFZSA-N |
| XLogP | 5.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|