About 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate
5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate (PubChem CID 11475055) has the molecular formula C24H30ClNO2
and a molecular weight of 399.96 g/mol. Its IUPAC name is 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate.
Molecular Properties
| Compound Name | 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate |
| PubChem CID | 11475055 |
| Molecular Formula | C24H30ClNO2 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](C(=O)OCCCCCc2ccccc2)C1 |
| InChI | InChI=1S/C24H30ClNO2/c1-26-16-15-22(20-11-13-21(25)14-12-20)23(18-26)24(27)28-17-7-3-6-10-19-8-4-2-5-9-19/h2,4-5,8-9,11-14,22-23H,3,6-7,10,15-18H2,1H3/t22-,23+/m1/s1 |
| InChIKey | WQPYOTZEECMDDI-PKTZIBPZSA-N |
| XLogP | 5.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate?
The IUPAC name of 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate (CID 11475055) is 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate.
What is the SMILES notation for 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate?
The canonical SMILES for 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate is CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](C(=O)OCCCCCc2ccccc2)C1.
What is the InChIKey of 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate?
The InChIKey is WQPYOTZEECMDDI-PKTZIBPZSA-N. The full InChI is InChI=1S/C24H30ClNO2/c1-26-16-15-22(20-11-13-21(25)14-12-20)23(18-26)24(27)28-17-7-3-6-10-19-8-4-2-5-9-19/h2,4-5,8-9,11-14,22-23H,3,6-7,10,15-18H2,1H3/t22-,23+/m1/s1.
What are the key properties of 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate?
5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate has a molecular weight of 399.96 g/mol, XLogP of 5.33, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpentyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate is sourced from PubChem (CID 11475055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).