C21H20FNO4S — CID 11475103
(1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(2-phenylphenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 11475103) has the molecular formula C21H20FNO4S and a molecular weight of 401.46 g/mol. Its IUPAC name is (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(2-phenylphenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(2-phenylphenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11475103 |
| Molecular Formula | C21H20FNO4S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(2-phenylphenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@]1(C(=O)O)[C@H]2[C@@H](C[C@H]1SCc1ccccc1-c1ccccc1)[C@]2(F)C(=O)O |
| InChI | InChI=1S/C21H20FNO4S/c22-20(18(24)25)15-10-16(21(23,17(15)20)19(26)27)28-11-13-8-4-5-9-14(13)12-6-2-1-3-7-12/h1-9,15-17H,10-11,23H2,(H,24,25)(H,26,27)/t15-,16-,17+,20-,21+/m1/s1 |
| InChIKey | ZYKJJWCFDLRIGS-ZUKOONMSSA-N |
| XLogP | 3.18 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |