C25H38O4 — CID 11475150
(3S,3aS,4S,6aS,10aR)-4-(hydroxymethyl)-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,4,6a,8-tetrahydro-3H-benzo[h][2]benzofuran-1-one (PubChem CID 11475150) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (3S,3aS,4S,6aS,10aR)-4-(hydroxymethyl)-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,4,6a,8-tetrahydro-3H-benzo[h][2]benzofuran-1-one.
| Compound Name | (3S,3aS,4S,6aS,10aR)-4-(hydroxymethyl)-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,4,6a,8-tetrahydro-3H-benzo[h][2]benzofuran-1-one |
|---|---|
| PubChem CID | 11475150 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (3S,3aS,4S,6aS,10aR)-4-(hydroxymethyl)-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-3a,4,6a,8-tetrahydro-3H-benzo[h][2]benzofuran-1-one |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1O[C@H]1OC(=O)[C@]23C=CCC(C)(C)[C@@H]2C=C[C@H](CO)[C@H]13 |
| InChI | InChI=1S/C25H38O4/c1-15(2)18-9-7-16(3)13-19(18)28-22-21-17(14-26)8-10-20-24(4,5)11-6-12-25(20,21)23(27)29-22/h6,8,10,12,15-22,26H,7,9,11,13-14H2,1-5H3/t16-,17+,18+,19-,20-,21+,22-,25+/m0/s1 |
| InChIKey | BGBDHBMHGIKHQC-RFQUFPIDSA-N |
| XLogP | 4.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|