C24H36O5 — CID 11475209
(E)-4-[(2E,6E,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid (PubChem CID 11475209) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (E)-4-[(2E,6E,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(2E,6E,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 11475209 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (E)-4-[(2E,6E,10E,14E)-16-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoxy]-4-oxobut-2-enoic acid |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)COC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H36O5/c1-19(10-6-12-21(3)16-17-25)8-5-9-20(2)11-7-13-22(4)18-29-24(28)15-14-23(26)27/h9-10,13-16,25H,5-8,11-12,17-18H2,1-4H3,(H,26,27)/b15-14+,19-10+,20-9+,21-16+,22-13+ |
| InChIKey | AEHIZBVRKDBILT-KCSPCAOWSA-N |
| XLogP | 5.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|