C23H38O4Si — CID 11475273
methyl (3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxyoct-7-enoate (PubChem CID 11475273) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is methyl (3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxyoct-7-enoate.
| Compound Name | methyl (3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxyoct-7-enoate |
|---|---|
| PubChem CID | 11475273 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | methyl (3S,5S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5-phenylmethoxyoct-7-enoate |
| SMILES | C=C[C@H](C)[C@H](C[C@@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C23H38O4Si/c1-9-18(2)21(26-17-19-13-11-10-12-14-19)15-20(16-22(24)25-6)27-28(7,8)23(3,4)5/h9-14,18,20-21H,1,15-17H2,2-8H3/t18-,20-,21-/m0/s1 |
| InChIKey | RRAISLIDWCKEAB-JBACZVJFSA-N |
| XLogP | 5.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|