C20H21ClN6O2 — CID 11475453
(2S)-3-[[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]-methylamino]propane-1,2-diol (PubChem CID 11475453) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is (2S)-3-[[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]-methylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]-methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 11475453 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (2S)-3-[[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]-methylamino]propane-1,2-diol |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N(C)C[C@H](O)CO)nc2n2cncc12 |
| InChI | InChI=1S/C20H21ClN6O2/c1-12-4-3-5-14(21)18(12)25-19-16-8-22-11-27(16)20-15(23-19)6-7-17(24-20)26(2)9-13(29)10-28/h3-8,11,13,28-29H,9-10H2,1-2H3,(H,23,25)/t13-/m0/s1 |
| InChIKey | NXXQJGWEAARZTQ-ZDUSSCGKSA-N |
| XLogP | 2.77 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |