C25H28F2O3 — CID 11475507
[(1R,3R,4R,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] (2S)-2-fluoro-2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 11475507) has the molecular formula C25H28F2O3 and a molecular weight of 414.49 g/mol. Its IUPAC name is [(1R,3R,4R,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] (2S)-2-fluoro-2-(3-fluoro-4-phenylphenyl)propanoate.
| Compound Name | [(1R,3R,4R,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] (2S)-2-fluoro-2-(3-fluoro-4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 11475507 |
| Molecular Formula | C25H28F2O3 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [(1R,3R,4R,6S)-4-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] (2S)-2-fluoro-2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CC1(C)[C@@H]2C[C@@H](OC(=O)[C@@](C)(F)c3ccc(-c4ccccc4)c(F)c3)[C@](C)(O)C[C@@H]21 |
| InChI | InChI=1S/C25H28F2O3/c1-23(2)18-13-21(24(3,29)14-19(18)23)30-22(28)25(4,27)16-10-11-17(20(26)12-16)15-8-6-5-7-9-15/h5-12,18-19,21,29H,13-14H2,1-4H3/t18-,19+,21-,24-,25+/m1/s1 |
| InChIKey | HLZXDEKNXUSYJE-LSJOYWLWSA-N |
| XLogP | 5.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |