C23H27ClN2O3 — CID 11475519
7-chloro-2-[4-methoxy-3-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-3H-isoindol-1-one (PubChem CID 11475519) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 7-chloro-2-[4-methoxy-3-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-3H-isoindol-1-one.
| Compound Name | 7-chloro-2-[4-methoxy-3-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 11475519 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 7-chloro-2-[4-methoxy-3-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-3H-isoindol-1-one |
| SMILES | COc1ccc(N2Cc3cccc(Cl)c3C2=O)cc1OCCN1CCC(C)CC1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-16-8-10-25(11-9-16)12-13-29-21-14-18(6-7-20(21)28-2)26-15-17-4-3-5-19(24)22(17)23(26)27/h3-7,14,16H,8-13,15H2,1-2H3 |
| InChIKey | NNOWVTHMEZYXKN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |