C12H17IN2O — CID 114755784
2-[1-[(4-amino-2-iodoanilino)methyl]cyclopropyl]ethanol (PubChem CID 114755784) has the molecular formula C12H17IN2O and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-[1-[(4-amino-2-iodoanilino)methyl]cyclopropyl]ethanol.
| Compound Name | 2-[1-[(4-amino-2-iodoanilino)methyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 114755784 |
| Molecular Formula | C12H17IN2O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-[1-[(4-amino-2-iodoanilino)methyl]cyclopropyl]ethanol |
| SMILES | Nc1ccc(NCC2(CCO)CC2)c(I)c1 |
| InChI | InChI=1S/C12H17IN2O/c13-10-7-9(14)1-2-11(10)15-8-12(3-4-12)5-6-16/h1-2,7,15-16H,3-6,8,14H2 |
| InChIKey | SOSLIUOKYHPBCK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|