C24H34O6 — CID 11475609
(2E,6E,10E,14E)-16-[(E)-3-carboxyprop-2-enoyl]oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid (PubChem CID 11475609) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (2E,6E,10E,14E)-16-[(E)-3-carboxyprop-2-enoyl]oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid.
| Compound Name | (2E,6E,10E,14E)-16-[(E)-3-carboxyprop-2-enoyl]oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 11475609 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (2E,6E,10E,14E)-16-[(E)-3-carboxyprop-2-enoyl]oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
| SMILES | C/C(=C\CC/C(C)=C/COC(=O)/C=C/C(=O)O)CC/C=C(\C)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C24H34O6/c1-18(8-5-9-19(2)12-7-13-21(4)24(28)29)10-6-11-20(3)16-17-30-23(27)15-14-22(25)26/h9-10,13-16H,5-8,11-12,17H2,1-4H3,(H,25,26)(H,28,29)/b15-14+,18-10+,19-9+,20-16+,21-13+ |
| InChIKey | ZGKBVLVSZSECNY-PAUNICHOSA-N |
| XLogP | 5.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|