C30H32O2 — CID 11475779
(2E,4E,6E)-7-[12-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]hepta-2,4,6-trien-1-ol (PubChem CID 11475779) has the molecular formula C30H32O2 and a molecular weight of 424.58 g/mol. Its IUPAC name is (2E,4E,6E)-7-[12-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]hepta-2,4,6-trien-1-ol.
| Compound Name | (2E,4E,6E)-7-[12-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]hepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 11475779 |
| Molecular Formula | C30H32O2 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (2E,4E,6E)-7-[12-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]hepta-2,4,6-trien-1-ol |
| SMILES | OC/C=C/C=C/C=C/c1cc2ccc1CCc1ccc(cc1/C=C/C=C/C=C/CO)CC2 |
| InChI | InChI=1S/C30H32O2/c31-21-9-5-1-3-7-11-29-23-25-13-14-26-16-18-28(20-19-27(29)17-15-25)30(24-26)12-8-4-2-6-10-22-32/h1-12,15-18,23-24,31-32H,13-14,19-22H2/b3-1+,4-2+,9-5+,10-6+,11-7+,12-8+ |
| InChIKey | XJKDDHGQJIHETP-RRXUTFQKSA-N |
| XLogP | 5.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|