C13H22ClN3O2S — CID 114758603
N-[[1-(2-chloroethyl)cyclopropyl]methyl]-2-methyl-1-propylimidazole-4-sulfonamide (PubChem CID 114758603) has the molecular formula C13H22ClN3O2S and a molecular weight of 319.86 g/mol. Its IUPAC name is N-[[1-(2-chloroethyl)cyclopropyl]methyl]-2-methyl-1-propylimidazole-4-sulfonamide.
| Compound Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-2-methyl-1-propylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 114758603 |
| Molecular Formula | C13H22ClN3O2S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-2-methyl-1-propylimidazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCC2(CCCl)CC2)nc1C |
| InChI | InChI=1S/C13H22ClN3O2S/c1-3-8-17-9-12(16-11(17)2)20(18,19)15-10-13(4-5-13)6-7-14/h9,15H,3-8,10H2,1-2H3 |
| InChIKey | SQNVRKBPGWOXCG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|