About 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea
1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea (PubChem CID 11475977) has the molecular formula C21H26F2N6O2
and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea.
Molecular Properties
| Compound Name | 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea |
| PubChem CID | 11475977 |
| Molecular Formula | C21H26F2N6O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea |
| SMILES | CC(C)CCNC(=O)Nc1ccc(N2CCN(C(=O)c3c(F)cccc3F)CC2)nn1 |
| InChI | InChI=1S/C21H26F2N6O2/c1-14(2)8-9-24-21(31)25-17-6-7-18(27-26-17)28-10-12-29(13-11-28)20(30)19-15(22)4-3-5-16(19)23/h3-7,14H,8-13H2,1-2H3,(H2,24,25,26,31) |
| InChIKey | HHOUJILDLXWSRC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea?
The IUPAC name of 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea (CID 11475977) is 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea.
What is the SMILES notation for 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea?
The canonical SMILES for 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea is CC(C)CCNC(=O)Nc1ccc(N2CCN(C(=O)c3c(F)cccc3F)CC2)nn1.
What is the InChIKey of 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea?
The InChIKey is HHOUJILDLXWSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26F2N6O2/c1-14(2)8-9-24-21(31)25-17-6-7-18(27-26-17)28-10-12-29(13-11-28)20(30)19-15(22)4-3-5-16(19)23/h3-7,14H,8-13H2,1-2H3,(H2,24,25,26,31).
What are the key properties of 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea?
1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea has a molecular weight of 432.48 g/mol, XLogP of 2.88, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]pyridazin-3-yl]-3-(3-methylbutyl)urea is sourced from PubChem (CID 11475977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).