About (3-methylphenyl)methanol
(3-methylphenyl)methanol (PubChem CID 11476) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is (3-methylphenyl)methanol.
Molecular Properties
| Compound Name | (3-methylphenyl)methanol |
| PubChem CID | 11476 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (3-methylphenyl)methanol |
| SMILES | Cc1cccc(CO)c1 |
| InChI | InChI=1S/C8H10O/c1-7-3-2-4-8(5-7)6-9/h2-5,9H,6H2,1H3 |
| InChIKey | JJCKHVUTVOPLBV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)methanol?
The IUPAC name of (3-methylphenyl)methanol (CID 11476) is (3-methylphenyl)methanol.
What is the SMILES notation for (3-methylphenyl)methanol?
The canonical SMILES for (3-methylphenyl)methanol is Cc1cccc(CO)c1.
What is the InChIKey of (3-methylphenyl)methanol?
The InChIKey is JJCKHVUTVOPLBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-7-3-2-4-8(5-7)6-9/h2-5,9H,6H2,1H3.
What are the key properties of (3-methylphenyl)methanol?
(3-methylphenyl)methanol has a molecular weight of 122.17 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methanol is sourced from PubChem (CID 11476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).