C22H29NO6S — CID 11476051
tert-butyl (2S)-1-[(2R)-2-methyl-2-(4-methylphenyl)sulfonylpent-4-enoyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 11476051) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2R)-2-methyl-2-(4-methylphenyl)sulfonylpent-4-enoyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2R)-2-methyl-2-(4-methylphenyl)sulfonylpent-4-enoyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11476051 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | tert-butyl (2S)-1-[(2R)-2-methyl-2-(4-methylphenyl)sulfonylpent-4-enoyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=CC[C@](C)(C(=O)N1C(=O)CC[C@H]1C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29NO6S/c1-7-14-22(6,30(27,28)16-10-8-15(2)9-11-16)20(26)23-17(12-13-18(23)24)19(25)29-21(3,4)5/h7-11,17H,1,12-14H2,2-6H3/t17-,22+/m0/s1 |
| InChIKey | YSIMYIHBNYSWPB-HTAPYJJXSA-N |
| XLogP | 2.96 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|