C13H21F3N2O2 — CID 114760629
N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 114760629) has the molecular formula C13H21F3N2O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114760629 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[(3-hydroxypyrrolidin-3-yl)methyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCC1(O)CCNC1)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3N2O2/c14-13(15,16)10-3-1-9(2-4-10)11(19)18-8-12(20)5-6-17-7-12/h9-10,17,20H,1-8H2,(H,18,19) |
| InChIKey | OFZXJSBFFMVSGJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |