C11H24N2O2 — CID 114761032
3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]pyrrolidin-3-ol (PubChem CID 114761032) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]pyrrolidin-3-ol.
| Compound Name | 3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 114761032 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-[[methyl(2-propan-2-yloxyethyl)amino]methyl]pyrrolidin-3-ol |
| SMILES | CC(C)OCCN(C)CC1(O)CCNC1 |
| InChI | InChI=1S/C11H24N2O2/c1-10(2)15-7-6-13(3)9-11(14)4-5-12-8-11/h10,12,14H,4-9H2,1-3H3 |
| InChIKey | ALVMMVQFAQPTAE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |