About 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one
3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one (PubChem CID 114761632) has the molecular formula C10H14BrNOS
and a molecular weight of 276.20 g/mol. Its IUPAC name is 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one |
| PubChem CID | 114761632 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one |
| SMILES | CC(C)(CS)Cn1cccc(Br)c1=O |
| InChI | InChI=1S/C10H14BrNOS/c1-10(2,7-14)6-12-5-3-4-8(11)9(12)13/h3-5,14H,6-7H2,1-2H3 |
| InChIKey | FVCSTSBNSLYUPA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one?
The IUPAC name of 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one (CID 114761632) is 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one.
What is the SMILES notation for 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one?
The canonical SMILES for 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one is CC(C)(CS)Cn1cccc(Br)c1=O.
What is the InChIKey of 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one?
The InChIKey is FVCSTSBNSLYUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrNOS/c1-10(2,7-14)6-12-5-3-4-8(11)9(12)13/h3-5,14H,6-7H2,1-2H3.
What are the key properties of 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one?
3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one has a molecular weight of 276.20 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-(2,2-dimethyl-3-sulfanylpropyl)pyridin-2-one is sourced from PubChem (CID 114761632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).