C14H23BF7N3O4 — CID 11476209
2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-2-amino-4-methylpentanoate;2,2,2-trifluoroacetic acid;tetrafluoroborate (PubChem CID 11476209) has the molecular formula C14H23BF7N3O4 and a molecular weight of 441.15 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-2-amino-4-methylpentanoate;2,2,2-trifluoroacetic acid;tetrafluoroborate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-2-amino-4-methylpentanoate;2,2,2-trifluoroacetic acid;tetrafluoroborate |
|---|---|
| PubChem CID | 11476209 |
| Molecular Formula | C14H23BF7N3O4 |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl (2S)-2-amino-4-methylpentanoate;2,2,2-trifluoroacetic acid;tetrafluoroborate |
| SMILES | CC(C)C[C@H](N)C(=O)OCCn1cc[n+](C)c1.F[B-](F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H22N3O2.C2HF3O2.BF4/c1-10(2)8-11(13)12(16)17-7-6-15-5-4-14(3)9-15;3-2(4,5)1(6)7;2-1(3,4)5/h4-5,9-11H,6-8,13H2,1-3H3;(H,6,7);/q+1;;-1/t11-;;/m0../s1 |
| InChIKey | NEOAJLXBJGZCHX-IDMXKUIJSA-N |
| XLogP | 2.16 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|