C23H26N2O5S — CID 11476256
2-(ethenylsulfonylamino)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-(4-methylphenyl)acetamide (PubChem CID 11476256) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-(ethenylsulfonylamino)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-(4-methylphenyl)acetamide.
| Compound Name | 2-(ethenylsulfonylamino)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 11476256 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-(ethenylsulfonylamino)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-(4-methylphenyl)acetamide |
| SMILES | C#CCOc1ccc(CCNC(=O)C(NS(=O)(=O)C=C)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C23H26N2O5S/c1-5-15-30-20-12-9-18(16-21(20)29-4)13-14-24-23(26)22(25-31(27,28)6-2)19-10-7-17(3)8-11-19/h1,6-12,16,22,25H,2,13-15H2,3-4H3,(H,24,26) |
| InChIKey | KSAYQCDNDJNWRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|