C23H26N2O5S — CID 11476257
N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-(4-formyl-2-propylphenyl)-N-(methoxymethyl)benzenesulfonamide (PubChem CID 11476257) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-(4-formyl-2-propylphenyl)-N-(methoxymethyl)benzenesulfonamide.
| Compound Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-(4-formyl-2-propylphenyl)-N-(methoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11476257 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-(4-formyl-2-propylphenyl)-N-(methoxymethyl)benzenesulfonamide |
| SMILES | CCCc1cc(C=O)ccc1-c1ccccc1S(=O)(=O)N(COC)c1noc(C)c1C |
| InChI | InChI=1S/C23H26N2O5S/c1-5-8-19-13-18(14-26)11-12-20(19)21-9-6-7-10-22(21)31(27,28)25(15-29-4)23-16(2)17(3)30-24-23/h6-7,9-14H,5,8,15H2,1-4H3 |
| InChIKey | DHAGNWNTSYKYPM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|