C11H6BrNO3 — CID 114763767
3-(5-bromo-1-benzofuran-2-yl)-4H-1,2-oxazol-5-one (PubChem CID 114763767) has the molecular formula C11H6BrNO3 and a molecular weight of 280.08 g/mol. Its IUPAC name is 3-(5-bromo-1-benzofuran-2-yl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(5-bromo-1-benzofuran-2-yl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 114763767 |
| Molecular Formula | C11H6BrNO3 |
| Molecular Weight | 280.08 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 3-(5-bromo-1-benzofuran-2-yl)-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(c2cc3cc(Br)ccc3o2)=NO1 |
| InChI | InChI=1S/C11H6BrNO3/c12-7-1-2-9-6(3-7)4-10(15-9)8-5-11(14)16-13-8/h1-4H,5H2 |
| InChIKey | NWQJFDPJXZGOTM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.08 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|