C10H6Br2FN — CID 114763946
3,4-dibromo-6-fluoro-8-methylquinoline (PubChem CID 114763946) has the molecular formula C10H6Br2FN and a molecular weight of 318.97 g/mol. Its IUPAC name is 3,4-dibromo-6-fluoro-8-methylquinoline.
| Compound Name | 3,4-dibromo-6-fluoro-8-methylquinoline |
|---|---|
| PubChem CID | 114763946 |
| Molecular Formula | C10H6Br2FN |
| Molecular Weight | 318.97 g/mol |
| Exact Mass | 316.89 |
| IUPAC Name | 3,4-dibromo-6-fluoro-8-methylquinoline |
| SMILES | Cc1cc(F)cc2c(Br)c(Br)cnc12 |
| InChI | InChI=1S/C10H6Br2FN/c1-5-2-6(13)3-7-9(12)8(11)4-14-10(5)7/h2-4H,1H3 |
| InChIKey | PQDNEJUHJAXVSP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |