C27H28O6 — CID 11476413
(3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-one (PubChem CID 11476413) has the molecular formula C27H28O6 and a molecular weight of 448.51 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-one |
|---|---|
| PubChem CID | 11476413 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-one |
| SMILES | O=C1O[C@H](CO)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O6/c28-16-23-24(30-17-20-10-4-1-5-11-20)25(31-18-21-12-6-2-7-13-21)26(27(29)33-23)32-19-22-14-8-3-9-15-22/h1-15,23-26,28H,16-19H2/t23-,24-,25+,26-/m1/s1 |
| InChIKey | XMZVKPUOVUMSAS-FXSWLTOZSA-N |
| XLogP | 3.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |