C21H40O8Si — CID 11476427
(2R,3R,4aS,5R,6S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6-(methoxymethoxy)-2,3,7-trimethyl-5,6,7,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-one (PubChem CID 11476427) has the molecular formula C21H40O8Si and a molecular weight of 448.63 g/mol. Its IUPAC name is (2R,3R,4aS,5R,6S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6-(methoxymethoxy)-2,3,7-trimethyl-5,6,7,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-one.
| Compound Name | (2R,3R,4aS,5R,6S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6-(methoxymethoxy)-2,3,7-trimethyl-5,6,7,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-one |
|---|---|
| PubChem CID | 11476427 |
| Molecular Formula | C21H40O8Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (2R,3R,4aS,5R,6S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-6-(methoxymethoxy)-2,3,7-trimethyl-5,6,7,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-one |
| SMILES | COCO[C@H]1C(C)C(=O)[C@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O8Si/c1-13-14(22)16-17(28-21(6,25-9)20(5,24-8)27-16)18(15(13)26-12-23-7)29-30(10,11)19(2,3)4/h13,15-18H,12H2,1-11H3/t13?,15-,16+,17-,18+,20+,21+/m0/s1 |
| InChIKey | XPWMAUUBOBKIBV-NSOPZWIFSA-N |
| XLogP | 3.09 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|