C24H29N5O4 — CID 11476483
(2R)-2-[[3-(4-acetylpiperazine-1-carbonyl)phenyl]carbamoylamino]-4-phenylbutanamide (PubChem CID 11476483) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is (2R)-2-[[3-(4-acetylpiperazine-1-carbonyl)phenyl]carbamoylamino]-4-phenylbutanamide.
| Compound Name | (2R)-2-[[3-(4-acetylpiperazine-1-carbonyl)phenyl]carbamoylamino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 11476483 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (2R)-2-[[3-(4-acetylpiperazine-1-carbonyl)phenyl]carbamoylamino]-4-phenylbutanamide |
| SMILES | CC(=O)N1CCN(C(=O)c2cccc(NC(=O)N[C@H](CCc3ccccc3)C(N)=O)c2)CC1 |
| InChI | InChI=1S/C24H29N5O4/c1-17(30)28-12-14-29(15-13-28)23(32)19-8-5-9-20(16-19)26-24(33)27-21(22(25)31)11-10-18-6-3-2-4-7-18/h2-9,16,21H,10-15H2,1H3,(H2,25,31)(H2,26,27,33)/t21-/m1/s1 |
| InChIKey | BJKMXKIYCZWZJH-OAQYLSRUSA-N |
| XLogP | 1.60 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |