C26H48O4Si — CID 11476514
(1S,5S,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodec-7-en-4-ol (PubChem CID 11476514) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is (1S,5S,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodec-7-en-4-ol.
| Compound Name | (1S,5S,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodec-7-en-4-ol |
|---|---|
| PubChem CID | 11476514 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (1S,5S,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(hydroxymethyl)-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodec-7-en-4-ol |
| SMILES | CC(C)=CCC[C@@]1(CO)C/C=C(\CO[Si](C)(C)C(C)(C)C)CC[C@@H]2O[C@@]2(C)CCC1O |
| InChI | InChI=1S/C26H48O4Si/c1-20(2)10-9-15-26(19-27)17-13-21(18-29-31(7,8)24(3,4)5)11-12-23-25(6,30-23)16-14-22(26)28/h10,13,22-23,27-28H,9,11-12,14-19H2,1-8H3/b21-13-/t22?,23-,25-,26-/m0/s1 |
| InChIKey | XGMQYEICTGJSAQ-ZWXMDTSPSA-N |
| XLogP | 6.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|