C11H13N3 — CID 114766194
2-methyl-6-[(2-methylcyclopropyl)amino]pyridine-4-carbonitrile (PubChem CID 114766194) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-methyl-6-[(2-methylcyclopropyl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-methyl-6-[(2-methylcyclopropyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114766194 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-methyl-6-[(2-methylcyclopropyl)amino]pyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(NC2CC2C)n1 |
| InChI | InChI=1S/C11H13N3/c1-7-3-10(7)14-11-5-9(6-12)4-8(2)13-11/h4-5,7,10H,3H2,1-2H3,(H,13,14) |
| InChIKey | KDCSLTKJHFNDPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |