C12H13N3 — CID 114766321
2-methyl-6-(2-methylbut-3-yn-2-ylamino)pyridine-4-carbonitrile (PubChem CID 114766321) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 2-methyl-6-(2-methylbut-3-yn-2-ylamino)pyridine-4-carbonitrile.
| Compound Name | 2-methyl-6-(2-methylbut-3-yn-2-ylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114766321 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-methyl-6-(2-methylbut-3-yn-2-ylamino)pyridine-4-carbonitrile |
| SMILES | C#CC(C)(C)Nc1cc(C#N)cc(C)n1 |
| InChI | InChI=1S/C12H13N3/c1-5-12(3,4)15-11-7-10(8-13)6-9(2)14-11/h1,6-7H,2-4H3,(H,14,15) |
| InChIKey | WXASUSSVFCZREP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|