C19H25NO12 — CID 11476664
methyl (3aR,4R,5R,6R,7aS)-4,5-diacetyloxy-6-(acetyloxymethyl)-7a-cyano-2,2-dimethoxy-3a,4,5,6-tetrahydro-3H-furo[2,3-b]pyran-3-carboxylate (PubChem CID 11476664) has the molecular formula C19H25NO12 and a molecular weight of 459.40 g/mol. Its IUPAC name is methyl (3aR,4R,5R,6R,7aS)-4,5-diacetyloxy-6-(acetyloxymethyl)-7a-cyano-2,2-dimethoxy-3a,4,5,6-tetrahydro-3H-furo[2,3-b]pyran-3-carboxylate.
| Compound Name | methyl (3aR,4R,5R,6R,7aS)-4,5-diacetyloxy-6-(acetyloxymethyl)-7a-cyano-2,2-dimethoxy-3a,4,5,6-tetrahydro-3H-furo[2,3-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 11476664 |
| Molecular Formula | C19H25NO12 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | methyl (3aR,4R,5R,6R,7aS)-4,5-diacetyloxy-6-(acetyloxymethyl)-7a-cyano-2,2-dimethoxy-3a,4,5,6-tetrahydro-3H-furo[2,3-b]pyran-3-carboxylate |
| SMILES | COC(=O)C1[C@@H]2[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O[C@]2(C#N)OC1(OC)OC |
| InChI | InChI=1S/C19H25NO12/c1-9(21)28-7-12-15(29-10(2)22)16(30-11(3)23)13-14(17(24)25-4)19(26-5,27-6)32-18(13,8-20)31-12/h12-16H,7H2,1-6H3/t12-,13-,14?,15+,16-,18-/m1/s1 |
| InChIKey | JOAIORPIRGVEHR-HAUPBYEDSA-N |
| XLogP | -0.59 |
| TPSA | 165.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|