C14H14ClN3S — CID 114767034
2-(3-chloro-4-methylanilino)-6-methylpyridine-4-carbothioamide (PubChem CID 114767034) has the molecular formula C14H14ClN3S and a molecular weight of 291.81 g/mol. Its IUPAC name is 2-(3-chloro-4-methylanilino)-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-(3-chloro-4-methylanilino)-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114767034 |
| Molecular Formula | C14H14ClN3S |
| Molecular Weight | 291.81 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-(3-chloro-4-methylanilino)-6-methylpyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H14ClN3S/c1-8-3-4-11(7-12(8)15)18-13-6-10(14(16)19)5-9(2)17-13/h3-7H,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | ORJNLNWAZYXABY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|