C13H19N3S — CID 114768007
2-(2,4-dimethylpyrrolidin-1-yl)-6-methylpyridine-4-carbothioamide (PubChem CID 114768007) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-(2,4-dimethylpyrrolidin-1-yl)-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-(2,4-dimethylpyrrolidin-1-yl)-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114768007 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-(2,4-dimethylpyrrolidin-1-yl)-6-methylpyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(N2CC(C)CC2C)n1 |
| InChI | InChI=1S/C13H19N3S/c1-8-4-10(3)16(7-8)12-6-11(13(14)17)5-9(2)15-12/h5-6,8,10H,4,7H2,1-3H3,(H2,14,17) |
| InChIKey | PLMYWZNXWGOBEQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|