C30H30N2O3 — CID 11476851
(3S,5R)-3,5-bis[4-(dimethylamino)phenyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione (PubChem CID 11476851) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is (3S,5R)-3,5-bis[4-(dimethylamino)phenyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione.
| Compound Name | (3S,5R)-3,5-bis[4-(dimethylamino)phenyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
|---|---|
| PubChem CID | 11476851 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (3S,5R)-3,5-bis[4-(dimethylamino)phenyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
| SMILES | CN(C)c1ccc([C@H]2CC(=O)C[C@@H](c3ccc(N(C)C)cc3)C23C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C30H30N2O3/c1-31(2)21-13-9-19(10-14-21)26-17-23(33)18-27(20-11-15-22(16-12-20)32(3)4)30(26)28(34)24-7-5-6-8-25(24)29(30)35/h5-16,26-27H,17-18H2,1-4H3/t26-,27+ |
| InChIKey | TYWXXWJBAJHBGS-MKPDMIMOSA-N |
| XLogP | 5.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|