About 3-chlorobenzaldehyde
3-chlorobenzaldehyde (PubChem CID 11477) has the molecular formula C7H5ClO
and a molecular weight of 140.57 g/mol. Its IUPAC name is 3-chlorobenzaldehyde.
Molecular Properties
| Compound Name | 3-chlorobenzaldehyde |
| PubChem CID | 11477 |
| Molecular Formula | C7H5ClO |
| Molecular Weight | 140.57 g/mol |
| Exact Mass | 140.00 |
| IUPAC Name | 3-chlorobenzaldehyde |
| SMILES | O=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C7H5ClO/c8-7-3-1-2-6(4-7)5-9/h1-5H |
| InChIKey | SRWILAKSARHZPR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzaldehyde?
The IUPAC name of 3-chlorobenzaldehyde (CID 11477) is 3-chlorobenzaldehyde.
What is the SMILES notation for 3-chlorobenzaldehyde?
The canonical SMILES for 3-chlorobenzaldehyde is O=Cc1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzaldehyde?
The InChIKey is SRWILAKSARHZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO/c8-7-3-1-2-6(4-7)5-9/h1-5H.
What are the key properties of 3-chlorobenzaldehyde?
3-chlorobenzaldehyde has a molecular weight of 140.57 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzaldehyde is sourced from PubChem (CID 11477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).