About 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole
2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole (PubChem CID 114771182) has the molecular formula C6H4BrN3O2
and a molecular weight of 230.02 g/mol. Its IUPAC name is 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole.
Analyze 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole (CID 114771182) is 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole is Cc1oncc1-c1nnc(Br)o1.
What is the InChIKey of 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole?
The InChIKey is JZQKIWPYBIISSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O2/c1-3-4(2-8-12-3)5-9-10-6(7)11-5/h2H,1H3.
What are the key properties of 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole?
2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole has a molecular weight of 230.02 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(5-methyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 114771182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).