C23H37N3O6Si — CID 11477151
[(3aS,5R,6S,7R,7aR)-7-acetyloxy-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-6-yl] acetate (PubChem CID 11477151) has the molecular formula C23H37N3O6Si and a molecular weight of 479.65 g/mol. Its IUPAC name is [(3aS,5R,6S,7R,7aR)-7-acetyloxy-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-6-yl] acetate.
| Compound Name | [(3aS,5R,6S,7R,7aR)-7-acetyloxy-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-6-yl] acetate |
|---|---|
| PubChem CID | 11477151 |
| Molecular Formula | C23H37N3O6Si |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | [(3aS,5R,6S,7R,7aR)-7-acetyloxy-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3a,5,6,7,7a-hexahydro-1H-pyrano[2,3-d]triazol-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2NNN(Cc3ccccc3)[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H37N3O6Si/c1-15(27)30-20-18(14-29-33(6,7)23(3,4)5)32-22-19(21(20)31-16(2)28)24-25-26(22)13-17-11-9-8-10-12-17/h8-12,18-22,24-25H,13-14H2,1-7H3/t18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | UNGJEBUUWLLTMC-LMYCIYFBSA-N |
| XLogP | 2.49 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|